About [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid
[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid (PubChem CID 67276718) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid |
| PubChem CID | 67276718 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(Cc1ccc(-c2nc3ccccc3s2)cn1)C(=O)O |
| InChI | InChI=1S/C18H19N3O2S/c1-18(2,3)21(17(22)23)11-13-9-8-12(10-19-13)16-20-14-6-4-5-7-15(14)24-16/h4-10H,11H2,1-3H3,(H,22,23) |
| InChIKey | ONRMCYBGAAVCNC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid?
The IUPAC name of [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid (CID 67276718) is [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid.
What is the SMILES notation for [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid?
The canonical SMILES for [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid is CC(C)(C)N(Cc1ccc(-c2nc3ccccc3s2)cn1)C(=O)O.
What is the InChIKey of [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid?
The InChIKey is ONRMCYBGAAVCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-18(2,3)21(17(22)23)11-13-9-8-12(10-19-13)16-20-14-6-4-5-7-15(14)24-16/h4-10H,11H2,1-3H3,(H,22,23).
What are the key properties of [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid?
[5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid has a molecular weight of 341.44 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-benzothiazol-2-yl)-2-pyridinyl]methyl-tert-butylcarbamic acid is sourced from PubChem (CID 67276718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).