C26H18IrN2S2 — CID 87517023
iridium;bis(2-phenyl-1,3-benzothiazole) (PubChem CID 87517023) has the molecular formula C26H18IrN2S2 and a molecular weight of 614.80 g/mol. Its IUPAC name is iridium;bis(2-phenyl-1,3-benzothiazole).
| Compound Name | iridium;bis(2-phenyl-1,3-benzothiazole) |
|---|---|
| PubChem CID | 87517023 |
| Molecular Formula | C26H18IrN2S2 |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | iridium;bis(2-phenyl-1,3-benzothiazole) |
| SMILES | [Ir].c1ccc(-c2nc3ccccc3s2)cc1.c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/2C13H9NS.Ir/c2*1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;/h2*1-9H; |
| InChIKey | ZPQKWGRIAJXEFX-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |