4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen

C13H12N2S — CID 145349668

IUPAC4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen
SMILESNc1ccc(-c2nc3ccccc3s2)cc1.[H][H]
InChIInChI=1S/C13H10N2S.H2/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13;/h1-8H,14H2;1H
InChIKeyLMZWDIUFVZLYRF-UHFFFAOYSA-N
MW228.32 g/mol
LogP3.79
Rot. Bonds1

About 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen

4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen (PubChem CID 145349668) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen.

Molecular Properties

Compound Name4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen
PubChem CID145349668
Molecular FormulaC13H12N2S
Molecular Weight228.32 g/mol
Exact Mass228.07
IUPAC Name4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen
SMILESNc1ccc(-c2nc3ccccc3s2)cc1.[H][H]
InChIInChI=1S/C13H10N2S.H2/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13;/h1-8H,14H2;1H
InChIKeyLMZWDIUFVZLYRF-UHFFFAOYSA-N
XLogP3.79
TPSA38.91 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.32
LogP ≤ 53.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen (CID 145349668) is 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen is Nc1ccc(-c2nc3ccccc3s2)cc1.[H][H].
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen?
The InChIKey is LMZWDIUFVZLYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2S.H2/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13;/h1-8H,14H2;1H.
What are the key properties of 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen?
4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen has a molecular weight of 228.32 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen is sourced from PubChem (CID 145349668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).