C13H12N2S — CID 145349668
4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen (PubChem CID 145349668) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen.
| Compound Name | 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen |
|---|---|
| PubChem CID | 145349668 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)aniline;molecular hydrogen |
| SMILES | Nc1ccc(-c2nc3ccccc3s2)cc1.[H][H] |
| InChI | InChI=1S/C13H10N2S.H2/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13;/h1-8H,14H2;1H |
| InChIKey | LMZWDIUFVZLYRF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|