C13H10NOPS — CID 59576597
[4-(1,3-benzothiazol-2-yl)phenoxy]phosphane (PubChem CID 59576597) has the molecular formula C13H10NOPS and a molecular weight of 259.27 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)phenoxy]phosphane.
| Compound Name | [4-(1,3-benzothiazol-2-yl)phenoxy]phosphane |
|---|---|
| PubChem CID | 59576597 |
| Molecular Formula | C13H10NOPS |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)phenoxy]phosphane |
| SMILES | POc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C13H10NOPS/c16-15-10-7-5-9(6-8-10)13-14-11-3-1-2-4-12(11)17-13/h1-8H,16H2 |
| InChIKey | LWCWDMBWXRVNRN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|