About 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one
3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one (PubChem CID 60623850) has the molecular formula C17H15NO2S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one.
Molecular Properties
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one |
| PubChem CID | 60623850 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one |
| SMILES | CC(=O)C(C)Oc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H15NO2S/c1-11(19)12(2)20-14-9-7-13(8-10-14)17-18-15-5-3-4-6-16(15)21-17/h3-10,12H,1-2H3 |
| InChIKey | RAGSJTIFMYAXLV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one?
The IUPAC name of 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one (CID 60623850) is 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one.
What is the SMILES notation for 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one?
The canonical SMILES for 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one is CC(=O)C(C)Oc1ccc(-c2nc3ccccc3s2)cc1.
What is the InChIKey of 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one?
The InChIKey is RAGSJTIFMYAXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2S/c1-11(19)12(2)20-14-9-7-13(8-10-14)17-18-15-5-3-4-6-16(15)21-17/h3-10,12H,1-2H3.
What are the key properties of 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one?
3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one has a molecular weight of 297.38 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-one is sourced from PubChem (CID 60623850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).