C24H21NO3S — CID 172832422
4-[1-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-yl]benzoic acid (PubChem CID 172832422) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is 4-[1-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-yl]benzoic acid.
| Compound Name | 4-[1-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 172832422 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[1-[4-(1,3-benzothiazol-2-yl)phenoxy]butan-2-yl]benzoic acid |
| SMILES | CCC(COc1ccc(-c2nc3ccccc3s2)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-2-16(17-7-9-19(10-8-17)24(26)27)15-28-20-13-11-18(12-14-20)23-25-21-5-3-4-6-22(21)29-23/h3-14,16H,2,15H2,1H3,(H,26,27) |
| InChIKey | VROBKNLRLRUFCG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |