C28H27N3O4S — CID 146224389
3-[[4-[[1-[4-(1,3-benzothiazol-2-yl)phenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]prop-2-enoic acid (PubChem CID 146224389) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is 3-[[4-[[1-[4-(1,3-benzothiazol-2-yl)phenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]prop-2-enoic acid.
| Compound Name | 3-[[4-[[1-[4-(1,3-benzothiazol-2-yl)phenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 146224389 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 3-[[4-[[1-[4-(1,3-benzothiazol-2-yl)phenoxy]-3-methylbutan-2-yl]amino]benzoyl]amino]prop-2-enoic acid |
| SMILES | CC(C)C(COc1ccc(-c2nc3ccccc3s2)cc1)Nc1ccc(C(=O)NC=CC(=O)O)cc1 |
| InChI | InChI=1S/C28H27N3O4S/c1-18(2)24(30-21-11-7-19(8-12-21)27(34)29-16-15-26(32)33)17-35-22-13-9-20(10-14-22)28-31-23-5-3-4-6-25(23)36-28/h3-16,18,24,30H,17H2,1-2H3,(H,29,34)(H,32,33) |
| InChIKey | SVKUBIVYYYTQGV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|