C22H19N3OS — CID 23996486
N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(dimethylamino)benzamide (PubChem CID 23996486) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 23996486 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2ccc(-c3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C22H19N3OS/c1-25(2)18-13-9-15(10-14-18)21(26)23-17-11-7-16(8-12-17)22-24-19-5-3-4-6-20(19)27-22/h3-14H,1-2H3,(H,23,26) |
| InChIKey | DFESBWCVOQPFNC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |