C20H13IN2OS — CID 2266955
N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-iodobenzamide (PubChem CID 2266955) has the molecular formula C20H13IN2OS and a molecular weight of 456.31 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-iodobenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 2266955 |
| Molecular Formula | C20H13IN2OS |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-3-iodobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cc1)c1cccc(I)c1 |
| InChI | InChI=1S/C20H13IN2OS/c21-15-5-3-4-14(12-15)19(24)22-16-10-8-13(9-11-16)20-23-17-6-1-2-7-18(17)25-20/h1-12H,(H,22,24) |
| InChIKey | CLBWDCRWFMGDMJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|