C20H12F2N2OS — CID 26173797
N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,4-difluorobenzamide (PubChem CID 26173797) has the molecular formula C20H12F2N2OS and a molecular weight of 366.39 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 26173797 |
| Molecular Formula | C20H12F2N2OS |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H12F2N2OS/c21-13-7-10-15(16(22)11-13)19(25)23-14-8-5-12(6-9-14)20-24-17-3-1-2-4-18(17)26-20/h1-11H,(H,23,25) |
| InChIKey | IDZISIJRGKKWBZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |