C21H14N2O3S — CID 55966907
N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzodioxole-4-carboxamide (PubChem CID 55966907) has the molecular formula C21H14N2O3S and a molecular weight of 374.42 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 55966907 |
| Molecular Formula | C21H14N2O3S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-1,3-benzodioxole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)cc1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C21H14N2O3S/c24-20(15-4-3-6-17-19(15)26-12-25-17)22-14-10-8-13(9-11-14)21-23-16-5-1-2-7-18(16)27-21/h1-11H,12H2,(H,22,24) |
| InChIKey | FXABNTJRJHSJFO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |