C30H20N2O6 — CID 101095834
N-[6-(1,3-benzodioxole-4-carbonylamino)anthracen-2-yl]-1,3-benzodioxole-4-carboxamide (PubChem CID 101095834) has the molecular formula C30H20N2O6 and a molecular weight of 504.50 g/mol. Its IUPAC name is N-[6-(1,3-benzodioxole-4-carbonylamino)anthracen-2-yl]-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[6-(1,3-benzodioxole-4-carbonylamino)anthracen-2-yl]-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 101095834 |
| Molecular Formula | C30H20N2O6 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-[6-(1,3-benzodioxole-4-carbonylamino)anthracen-2-yl]-1,3-benzodioxole-4-carboxamide |
| SMILES | O=C(Nc1ccc2cc3cc(NC(=O)c4cccc5c4OCO5)ccc3cc2c1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C30H20N2O6/c33-29(23-3-1-5-25-27(23)37-15-35-25)31-21-9-7-17-12-20-14-22(10-8-18(20)11-19(17)13-21)32-30(34)24-4-2-6-26-28(24)38-16-36-26/h1-14H,15-16H2,(H,31,33)(H,32,34) |
| InChIKey | CAAPPBHOTSEEFV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|