C8H5O4- — CID 6946476
1,3-benzodioxole-4-carboxylate (PubChem CID 6946476) has the molecular formula C8H5O4- and a molecular weight of 165.12 g/mol. Its IUPAC name is 1,3-benzodioxole-4-carboxylate.
| Compound Name | 1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 6946476 |
| Molecular Formula | C8H5O4- |
| Molecular Weight | 165.12 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 1,3-benzodioxole-4-carboxylate |
| SMILES | O=C([O-])c1cccc2c1OCO2 |
| InChI | InChI=1S/C8H6O4/c9-8(10)5-2-1-3-6-7(5)12-4-11-6/h1-3H,4H2,(H,9,10)/p-1 |
| InChIKey | DBUAYOWCIUQXQW-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |