C37H28O16 — CID 54404719
[3-(1,3-benzodioxole-4-carbonyloxy)-2,2-bis(1,3-benzodioxole-4-carbonyloxymethyl)propyl] 1,3-benzodioxole-4-carboxylate (PubChem CID 54404719) has the molecular formula C37H28O16 and a molecular weight of 728.62 g/mol. Its IUPAC name is [3-(1,3-benzodioxole-4-carbonyloxy)-2,2-bis(1,3-benzodioxole-4-carbonyloxymethyl)propyl] 1,3-benzodioxole-4-carboxylate.
| Compound Name | [3-(1,3-benzodioxole-4-carbonyloxy)-2,2-bis(1,3-benzodioxole-4-carbonyloxymethyl)propyl] 1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 54404719 |
| Molecular Formula | C37H28O16 |
| Molecular Weight | 728.62 g/mol |
| Exact Mass | 728.14 |
| IUPAC Name | [3-(1,3-benzodioxole-4-carbonyloxy)-2,2-bis(1,3-benzodioxole-4-carbonyloxymethyl)propyl] 1,3-benzodioxole-4-carboxylate |
| SMILES | O=C(OCC(COC(=O)c1cccc2c1OCO2)(COC(=O)c1cccc2c1OCO2)COC(=O)c1cccc2c1OCO2)c1cccc2c1OCO2 |
| InChI | InChI=1S/C37H28O16/c38-33(21-5-1-9-25-29(21)50-17-46-25)42-13-37(14-43-34(39)22-6-2-10-26-30(22)51-18-47-26,15-44-35(40)23-7-3-11-27-31(23)52-19-48-27)16-45-36(41)24-8-4-12-28-32(24)53-20-49-28/h1-12H,13-20H2 |
| InChIKey | VPWPBYRSMZXYRI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|