C10H10O4 — CID 176849330
ethyl 2,2-dideuterio-1,3-benzodioxole-4-carboxylate (PubChem CID 176849330) has the molecular formula C10H10O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is ethyl 2,2-dideuterio-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl 2,2-dideuterio-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 176849330 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | ethyl 2,2-dideuterio-1,3-benzodioxole-4-carboxylate |
| SMILES | [2H]C1([2H])Oc2cccc(C(=O)OCC)c2O1 |
| InChI | InChI=1S/C10H10O4/c1-2-12-10(11)7-4-3-5-8-9(7)14-6-13-8/h3-5H,2,6H2,1H3/i6D2 |
| InChIKey | TYQKHCZKVCIXAJ-NCYHJHSESA-N |
| XLogP | 1.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |