C17H20O4 — CID 60594429
(6-methylcyclohex-3-en-1-yl)methyl 2,3-dihydro-1,4-benzodioxine-5-carboxylate (PubChem CID 60594429) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (6-methylcyclohex-3-en-1-yl)methyl 2,3-dihydro-1,4-benzodioxine-5-carboxylate.
| Compound Name | (6-methylcyclohex-3-en-1-yl)methyl 2,3-dihydro-1,4-benzodioxine-5-carboxylate |
|---|---|
| PubChem CID | 60594429 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (6-methylcyclohex-3-en-1-yl)methyl 2,3-dihydro-1,4-benzodioxine-5-carboxylate |
| SMILES | CC1CC=CCC1COC(=O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C17H20O4/c1-12-5-2-3-6-13(12)11-21-17(18)14-7-4-8-15-16(14)20-10-9-19-15/h2-4,7-8,12-13H,5-6,9-11H2,1H3 |
| InChIKey | OQXGCZZODNVSQD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|