C12H15NO4 — CID 110699403
N-(3-methoxypropyl)-1,3-benzodioxole-4-carboxamide (PubChem CID 110699403) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 110699403 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(3-methoxypropyl)-1,3-benzodioxole-4-carboxamide |
| SMILES | COCCCNC(=O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-15-7-3-6-13-12(14)9-4-2-5-10-11(9)17-8-16-10/h2,4-5H,3,6-8H2,1H3,(H,13,14) |
| InChIKey | VZENLJFZXWPSMS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|