C15H20INO3 — CID 107848624
N-(6-iodohexyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 107848624) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is N-(6-iodohexyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(6-iodohexyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 107848624 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-(6-iodohexyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | O=C(NCCCCCCI)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H20INO3/c16-8-3-1-2-4-9-17-15(18)12-6-5-7-13-14(12)20-11-10-19-13/h5-7H,1-4,8-11H2,(H,17,18) |
| InChIKey | WCDVELDFESVRIJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|