C16H22I2N2O2 — CID 139952452
1-N,2-N-bis(4-iodobutyl)benzene-1,2-dicarboxamide (PubChem CID 139952452) has the molecular formula C16H22I2N2O2 and a molecular weight of 528.17 g/mol. Its IUPAC name is 1-N,2-N-bis(4-iodobutyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis(4-iodobutyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139952452 |
| Molecular Formula | C16H22I2N2O2 |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 1-N,2-N-bis(4-iodobutyl)benzene-1,2-dicarboxamide |
| SMILES | O=C(NCCCCI)c1ccccc1C(=O)NCCCCI |
| InChI | InChI=1S/C16H22I2N2O2/c17-9-3-5-11-19-15(21)13-7-1-2-8-14(13)16(22)20-12-6-4-10-18/h1-2,7-8H,3-6,9-12H2,(H,19,21)(H,20,22) |
| InChIKey | CBNWEMFQIKUJFD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|