C16H26N4O2 — CID 171064318
1-N,2-N-bis(4-aminobutyl)benzene-1,2-dicarboxamide (PubChem CID 171064318) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-N,2-N-bis(4-aminobutyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis(4-aminobutyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 171064318 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-N,2-N-bis(4-aminobutyl)benzene-1,2-dicarboxamide |
| SMILES | NCCCCNC(=O)c1ccccc1C(=O)NCCCCN |
| InChI | InChI=1S/C16H26N4O2/c17-9-3-5-11-19-15(21)13-7-1-2-8-14(13)16(22)20-12-6-4-10-18/h1-2,7-8H,3-6,9-12,17-18H2,(H,19,21)(H,20,22) |
| InChIKey | JADSSZJNEIQBMX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|