C10H10Cl2INO — CID 114504005
2,3-dichloro-N-(3-iodopropyl)benzamide (PubChem CID 114504005) has the molecular formula C10H10Cl2INO and a molecular weight of 358.01 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-iodopropyl)benzamide.
| Compound Name | 2,3-dichloro-N-(3-iodopropyl)benzamide |
|---|---|
| PubChem CID | 114504005 |
| Molecular Formula | C10H10Cl2INO |
| Molecular Weight | 358.01 g/mol |
| Exact Mass | 356.92 |
| IUPAC Name | 2,3-dichloro-N-(3-iodopropyl)benzamide |
| SMILES | O=C(NCCCI)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2INO/c11-8-4-1-3-7(9(8)12)10(15)14-6-2-5-13/h1,3-4H,2,5-6H2,(H,14,15) |
| InChIKey | GSWZWHSDVIZHOY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|