C10H13Cl2NO — CID 158305709
2,3-dichloro-N-ethylbenzamide;methane (PubChem CID 158305709) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is 2,3-dichloro-N-ethylbenzamide;methane.
| Compound Name | 2,3-dichloro-N-ethylbenzamide;methane |
|---|---|
| PubChem CID | 158305709 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2,3-dichloro-N-ethylbenzamide;methane |
| SMILES | C.CCNC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl2NO.CH4/c1-2-12-9(13)6-4-3-5-7(10)8(6)11;/h3-5H,2H2,1H3,(H,12,13);1H4 |
| InChIKey | GNBBRCPHNIRLSG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |