C7H5Cl2NOS — CID 71773851
2,3-dichloro-N-sulfanylbenzamide (PubChem CID 71773851) has the molecular formula C7H5Cl2NOS and a molecular weight of 222.10 g/mol. Its IUPAC name is 2,3-dichloro-N-sulfanylbenzamide.
| Compound Name | 2,3-dichloro-N-sulfanylbenzamide |
|---|---|
| PubChem CID | 71773851 |
| Molecular Formula | C7H5Cl2NOS |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 220.95 |
| IUPAC Name | 2,3-dichloro-N-sulfanylbenzamide |
| SMILES | O=C(NS)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C7H5Cl2NOS/c8-5-3-1-2-4(6(5)9)7(11)10-12/h1-3,12H,(H,10,11) |
| InChIKey | INEMOCSNASRCEY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|