C14H6Cl4O3 — CID 20714991
(2,3-dichlorobenzoyl) 2,3-dichlorobenzoate (PubChem CID 20714991) has the molecular formula C14H6Cl4O3 and a molecular weight of 364.01 g/mol. Its IUPAC name is (2,3-dichlorobenzoyl) 2,3-dichlorobenzoate.
| Compound Name | (2,3-dichlorobenzoyl) 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 20714991 |
| Molecular Formula | C14H6Cl4O3 |
| Molecular Weight | 364.01 g/mol |
| Exact Mass | 361.91 |
| IUPAC Name | (2,3-dichlorobenzoyl) 2,3-dichlorobenzoate |
| SMILES | O=C(OC(=O)c1cccc(Cl)c1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H6Cl4O3/c15-9-5-1-3-7(11(9)17)13(19)21-14(20)8-4-2-6-10(16)12(8)18/h1-6H |
| InChIKey | PQQZYNVQDUZLTQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|