methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate

C10H8Cl2O3 — CID 19088196

IUPACmethyl 3-(2,3-dichlorophenyl)-3-oxopropanoate
SMILESCOC(=O)CC(=O)c1cccc(Cl)c1Cl
InChIInChI=1S/C10H8Cl2O3/c1-15-9(14)5-8(13)6-3-2-4-7(11)10(6)12/h2-4H,5H2,1H3
InChIKeySQTFVSFVAGJAFV-UHFFFAOYSA-N
MW247.08 g/mol
LogP2.74
Rot. Bonds3

About methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate

methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate (PubChem CID 19088196) has the molecular formula C10H8Cl2O3 and a molecular weight of 247.08 g/mol. Its IUPAC name is methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate.

Molecular Properties

Compound Namemethyl 3-(2,3-dichlorophenyl)-3-oxopropanoate
PubChem CID19088196
Molecular FormulaC10H8Cl2O3
Molecular Weight247.08 g/mol
Exact Mass245.99
IUPAC Namemethyl 3-(2,3-dichlorophenyl)-3-oxopropanoate
SMILESCOC(=O)CC(=O)c1cccc(Cl)c1Cl
InChIInChI=1S/C10H8Cl2O3/c1-15-9(14)5-8(13)6-3-2-4-7(11)10(6)12/h2-4H,5H2,1H3
InChIKeySQTFVSFVAGJAFV-UHFFFAOYSA-N
XLogP2.74
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.08
LogP ≤ 52.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate?
The IUPAC name of methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate (CID 19088196) is methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate.
What is the SMILES notation for methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate?
The canonical SMILES for methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate is COC(=O)CC(=O)c1cccc(Cl)c1Cl.
What is the InChIKey of methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate?
The InChIKey is SQTFVSFVAGJAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2O3/c1-15-9(14)5-8(13)6-3-2-4-7(11)10(6)12/h2-4H,5H2,1H3.
What are the key properties of methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate?
methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate has a molecular weight of 247.08 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dichlorophenyl)-3-oxopropanoate is sourced from PubChem (CID 19088196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).