C12H9Cl2NO3 — CID 82667628
methyl 3-(6,7-dichloro-1H-indol-3-yl)-3-oxopropanoate (PubChem CID 82667628) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is methyl 3-(6,7-dichloro-1H-indol-3-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(6,7-dichloro-1H-indol-3-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82667628 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | methyl 3-(6,7-dichloro-1H-indol-3-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1c[nH]c2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C12H9Cl2NO3/c1-18-10(17)4-9(16)7-5-15-12-6(7)2-3-8(13)11(12)14/h2-3,5,15H,4H2,1H3 |
| InChIKey | PHBPYUKECGNOPX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|