C13H10F3NO3 — CID 82667620
methyl 3-oxo-3-[6-(trifluoromethyl)-1H-indol-3-yl]propanoate (PubChem CID 82667620) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is methyl 3-oxo-3-[6-(trifluoromethyl)-1H-indol-3-yl]propanoate.
| Compound Name | methyl 3-oxo-3-[6-(trifluoromethyl)-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 82667620 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 3-oxo-3-[6-(trifluoromethyl)-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)CC(=O)c1c[nH]c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C13H10F3NO3/c1-20-12(19)5-11(18)9-6-17-10-4-7(13(14,15)16)2-3-8(9)10/h2-4,6,17H,5H2,1H3 |
| InChIKey | UFVNGFGBQDDSDR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|