C14H10F3NO5 — CID 18929856
dimethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2,3-dicarboxylate (PubChem CID 18929856) has the molecular formula C14H10F3NO5 and a molecular weight of 329.23 g/mol. Its IUPAC name is dimethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2,3-dicarboxylate.
| Compound Name | dimethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 18929856 |
| Molecular Formula | C14H10F3NO5 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | dimethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-2,3-dicarboxylate |
| SMILES | COC(=O)c1[nH]c2cc(C(F)(F)F)ccc2c(=O)c1C(=O)OC |
| InChI | InChI=1S/C14H10F3NO5/c1-22-12(20)9-10(13(21)23-2)18-8-5-6(14(15,16)17)3-4-7(8)11(9)19/h3-5H,1-2H3,(H,18,19) |
| InChIKey | AKVYWURTWJYRRN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |