C11H9F3N2O2 — CID 614749
methyl 2-amino-6-(trifluoromethyl)-1H-indole-3-carboxylate (PubChem CID 614749) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is methyl 2-amino-6-(trifluoromethyl)-1H-indole-3-carboxylate.
| Compound Name | methyl 2-amino-6-(trifluoromethyl)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 614749 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | methyl 2-amino-6-(trifluoromethyl)-1H-indole-3-carboxylate |
| SMILES | COC(=O)c1c(N)[nH]c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H9F3N2O2/c1-18-10(17)8-6-3-2-5(11(12,13)14)4-7(6)16-9(8)15/h2-4,16H,15H2,1H3 |
| InChIKey | XAWWTCCYXHDTFT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |