C18H11F6NO2 — CID 155519157
methyl 6-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate (PubChem CID 155519157) has the molecular formula C18H11F6NO2 and a molecular weight of 387.28 g/mol. Its IUPAC name is methyl 6-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate.
| Compound Name | methyl 6-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 155519157 |
| Molecular Formula | C18H11F6NO2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | methyl 6-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(C(F)(F)F)ccc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F6NO2/c1-27-16(26)15-14(9-2-4-10(5-3-9)17(19,20)21)12-7-6-11(18(22,23)24)8-13(12)25-15/h2-8,25H,1H3 |
| InChIKey | TUJQGXKFEGLWCM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |