C22H17NO2 — CID 135386958
methyl 3,5-diphenyl-1H-indole-2-carboxylate (PubChem CID 135386958) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 3,5-diphenyl-1H-indole-2-carboxylate.
| Compound Name | methyl 3,5-diphenyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 135386958 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 3,5-diphenyl-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc(-c3ccccc3)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C22H17NO2/c1-25-22(24)21-20(16-10-6-3-7-11-16)18-14-17(12-13-19(18)23-21)15-8-4-2-5-9-15/h2-14,23H,1H3 |
| InChIKey | XZDRWJXXDSHZPT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |