C17H16N2O3 — CID 11522202
5,6-dimethoxy-3-phenyl-1H-indole-2-carboxamide (PubChem CID 11522202) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 5,6-dimethoxy-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5,6-dimethoxy-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11522202 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5,6-dimethoxy-3-phenyl-1H-indole-2-carboxamide |
| SMILES | COc1cc2[nH]c(C(N)=O)c(-c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C17H16N2O3/c1-21-13-8-11-12(9-14(13)22-2)19-16(17(18)20)15(11)10-6-4-3-5-7-10/h3-9,19H,1-2H3,(H2,18,20) |
| InChIKey | LRJRYRFBXQZDRU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |