C18H16ClNO4 — CID 11573768
methyl 3-(3-chlorophenyl)-5,6-dimethoxy-1H-indole-2-carboxylate (PubChem CID 11573768) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-5,6-dimethoxy-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(3-chlorophenyl)-5,6-dimethoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 11573768 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-5,6-dimethoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)c(OC)cc2c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO4/c1-22-14-8-12-13(9-15(14)23-2)20-17(18(21)24-3)16(12)10-5-4-6-11(19)7-10/h4-9,20H,1-3H3 |
| InChIKey | NQCOHWFQRSVAHH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |