C20H16ClNO2 — CID 166154515
methyl 3-(3-chlorophenyl)-4,5-dihydro-1H-benzo[g]indole-2-carboxylate (PubChem CID 166154515) has the molecular formula C20H16ClNO2 and a molecular weight of 337.81 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-4,5-dihydro-1H-benzo[g]indole-2-carboxylate.
| Compound Name | methyl 3-(3-chlorophenyl)-4,5-dihydro-1H-benzo[g]indole-2-carboxylate |
|---|---|
| PubChem CID | 166154515 |
| Molecular Formula | C20H16ClNO2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-4,5-dihydro-1H-benzo[g]indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2c(c1-c1cccc(Cl)c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C20H16ClNO2/c1-24-20(23)19-17(13-6-4-7-14(21)11-13)16-10-9-12-5-2-3-8-15(12)18(16)22-19/h2-8,11,22H,9-10H2,1H3 |
| InChIKey | NKYXIVORSSPLSF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |