C18H21NO2 — CID 166661292
tert-butyl 3-methyl-4,5-dihydro-1H-benzo[g]indole-2-carboxylate (PubChem CID 166661292) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 3-methyl-4,5-dihydro-1H-benzo[g]indole-2-carboxylate.
| Compound Name | tert-butyl 3-methyl-4,5-dihydro-1H-benzo[g]indole-2-carboxylate |
|---|---|
| PubChem CID | 166661292 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | tert-butyl 3-methyl-4,5-dihydro-1H-benzo[g]indole-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)C)[nH]c2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C18H21NO2/c1-11-13-10-9-12-7-5-6-8-14(12)16(13)19-15(11)17(20)21-18(2,3)4/h5-8,19H,9-10H2,1-4H3 |
| InChIKey | QSTQQVIORFWLNZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |