C21H21NO2 — CID 132567342
tert-butyl 5,6-dihydronaphtho[2,1-b]indolizine-7-carboxylate (PubChem CID 132567342) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 5,6-dihydronaphtho[2,1-b]indolizine-7-carboxylate.
| Compound Name | tert-butyl 5,6-dihydronaphtho[2,1-b]indolizine-7-carboxylate |
|---|---|
| PubChem CID | 132567342 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | tert-butyl 5,6-dihydronaphtho[2,1-b]indolizine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c2c(n3ccccc13)-c1ccccc1CC2 |
| InChI | InChI=1S/C21H21NO2/c1-21(2,3)24-20(23)18-16-12-11-14-8-4-5-9-15(14)19(16)22-13-7-6-10-17(18)22/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | WCILDMQSNQYPOK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |