C17H19NO3 — CID 68683428
tert-butyl 3-oxo-2,4-dihydro-1H-pyrido[1,2-a]indole-4-carboxylate (PubChem CID 68683428) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl 3-oxo-2,4-dihydro-1H-pyrido[1,2-a]indole-4-carboxylate.
| Compound Name | tert-butyl 3-oxo-2,4-dihydro-1H-pyrido[1,2-a]indole-4-carboxylate |
|---|---|
| PubChem CID | 68683428 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | tert-butyl 3-oxo-2,4-dihydro-1H-pyrido[1,2-a]indole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)CCc2cc3ccccn3c21 |
| InChI | InChI=1S/C17H19NO3/c1-17(2,3)21-16(20)14-13(19)8-7-11-10-12-6-4-5-9-18(12)15(11)14/h4-6,9-10,14H,7-8H2,1-3H3 |
| InChIKey | MAPNHNTUZJTUIH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|