About tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate
tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate (PubChem CID 121468825) has the molecular formula C17H18FNO3
and a molecular weight of 303.33 g/mol. Its IUPAC name is tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate |
| PubChem CID | 121468825 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)CCc2cc3cc(F)ccc3n21 |
| InChI | InChI=1S/C17H18FNO3/c1-17(2,3)22-16(21)15-14(20)7-5-12-9-10-8-11(18)4-6-13(10)19(12)15/h4,6,8-9,15H,5,7H2,1-3H3 |
| InChIKey | LEYOHFLAQLGDSS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate?
The IUPAC name of tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate (CID 121468825) is tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate.
What is the SMILES notation for tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate?
The canonical SMILES for tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate is CC(C)(C)OC(=O)C1C(=O)CCc2cc3cc(F)ccc3n21.
What is the InChIKey of tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate?
The InChIKey is LEYOHFLAQLGDSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO3/c1-17(2,3)22-16(21)15-14(20)7-5-12-9-10-8-11(18)4-6-13(10)19(12)15/h4,6,8-9,15H,5,7H2,1-3H3.
What are the key properties of tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate?
tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate has a molecular weight of 303.33 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate is sourced from PubChem (CID 121468825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).