C17H18FNO3 — CID 121468825
tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate (PubChem CID 121468825) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate.
| Compound Name | tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate |
|---|---|
| PubChem CID | 121468825 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | tert-butyl 2-fluoro-7-oxo-8,9-dihydro-6H-pyrido[1,2-a]indole-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)CCc2cc3cc(F)ccc3n21 |
| InChI | InChI=1S/C17H18FNO3/c1-17(2,3)22-16(21)15-14(20)7-5-12-9-10-8-11(18)4-6-13(10)19(12)15/h4,6,8-9,15H,5,7H2,1-3H3 |
| InChIKey | LEYOHFLAQLGDSS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|