About tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate
tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate (PubChem CID 141048391) has the molecular formula C17H21FN2O2
and a molecular weight of 304.37 g/mol. Its IUPAC name is tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
| PubChem CID | 141048391 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)Cc2cc3ccc(F)cc3n21 |
| InChI | InChI=1S/C17H21FN2O2/c1-11-9-19(16(21)22-17(2,3)4)10-14-7-12-5-6-13(18)8-15(12)20(11)14/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | AHCRNEMQXDZBJS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
The IUPAC name of tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate (CID 141048391) is tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate.
What is the SMILES notation for tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
The canonical SMILES for tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate is CC1CN(C(=O)OC(C)(C)C)Cc2cc3ccc(F)cc3n21.
What is the InChIKey of tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
The InChIKey is AHCRNEMQXDZBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN2O2/c1-11-9-19(16(21)22-17(2,3)4)10-14-7-12-5-6-13(18)8-15(12)20(11)14/h5-8,11H,9-10H2,1-4H3.
What are the key properties of tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate has a molecular weight of 304.37 g/mol, XLogP of 4.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-fluoro-4-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate is sourced from PubChem (CID 141048391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).