C11H21NO6 — CID 139845782
tert-butyl (3R,4R,5R,6S)-3,4,5,6-tetrahydroxyazepane-1-carboxylate (PubChem CID 139845782) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is tert-butyl (3R,4R,5R,6S)-3,4,5,6-tetrahydroxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4R,5R,6S)-3,4,5,6-tetrahydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 139845782 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | tert-butyl (3R,4R,5R,6S)-3,4,5,6-tetrahydroxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H21NO6/c1-11(2,3)18-10(17)12-4-6(13)8(15)9(16)7(14)5-12/h6-9,13-16H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | FNXAKFYNSWLSCP-BZNPZCIMSA-N |
| XLogP | -1.32 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |