C18H30N2O4 — CID 118111531
ditert-butyl 4,9-diazatricyclo[5.3.0.02,6]decane-4,9-dicarboxylate (PubChem CID 118111531) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is ditert-butyl 4,9-diazatricyclo[5.3.0.02,6]decane-4,9-dicarboxylate.
| Compound Name | ditert-butyl 4,9-diazatricyclo[5.3.0.02,6]decane-4,9-dicarboxylate |
|---|---|
| PubChem CID | 118111531 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | ditert-butyl 4,9-diazatricyclo[5.3.0.02,6]decane-4,9-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)C1CN(C(=O)OC(C)(C)C)CC21 |
| InChI | InChI=1S/C18H30N2O4/c1-17(2,3)23-15(21)19-7-11-12(8-19)14-10-20(9-13(11)14)16(22)24-18(4,5)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | SJMIQGSZTCGLTG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |