C14H29NO2 — CID 164877477
tert-butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate;ethane (PubChem CID 164877477) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is tert-butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate;ethane.
| Compound Name | tert-butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate;ethane |
|---|---|
| PubChem CID | 164877477 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | tert-butyl 3-azabicyclo[3.1.0]hexane-3-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CC2CC2C1 |
| InChI | InChI=1S/C10H17NO2.2C2H6/c1-10(2,3)13-9(12)11-5-7-4-8(7)6-11;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | JZEBJDHPPRDQRN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |