C14H23NO2 — CID 155401752
tert-butyl 5-azatricyclo[5.2.1.03,9]decane-5-carboxylate (PubChem CID 155401752) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is tert-butyl 5-azatricyclo[5.2.1.03,9]decane-5-carboxylate.
| Compound Name | tert-butyl 5-azatricyclo[5.2.1.03,9]decane-5-carboxylate |
|---|---|
| PubChem CID | 155401752 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | tert-butyl 5-azatricyclo[5.2.1.03,9]decane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC3CC(C1)C3C2 |
| InChI | InChI=1S/C14H23NO2/c1-14(2,3)17-13(16)15-7-9-4-10-6-11(8-15)12(10)5-9/h9-12H,4-8H2,1-3H3 |
| InChIKey | SKVAGKQCIMMVGM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |