C11H21NO4 — CID 57078219
tert-butyl (3S,4S)-3,4-dimethoxypyrrolidine-1-carboxylate (PubChem CID 57078219) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3,4-dimethoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3,4-dimethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57078219 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | tert-butyl (3S,4S)-3,4-dimethoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1OC |
| InChI | InChI=1S/C11H21NO4/c1-11(2,3)16-10(13)12-6-8(14-4)9(7-12)15-5/h8-9H,6-7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | ZXITZSJZHVBMJL-IUCAKERBSA-N |
| XLogP | 1.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |