C22H34N2O6 — CID 171363629
tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 171363629) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 171363629 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | tert-butyl (1S,5R)-6-formyl-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C(C=O)[C@@H]2C1.CC(C)(C)OC(=O)N1C[C@@H]2C(C=O)[C@@H]2C1 |
| InChI | InChI=1S/2C11H17NO3/c2*1-11(2,3)15-10(14)12-4-7-8(5-12)9(7)6-13/h2*6-9H,4-5H2,1-3H3/t2*7-,8+,9? |
| InChIKey | JMDJHZSOHBSXQN-FWNVCWPFSA-N |
| XLogP | 2.60 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|