About tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate
tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate (PubChem CID 156709755) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate.
Molecular Properties
| Compound Name | tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate |
| PubChem CID | 156709755 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate |
| SMILES | CC.CC(C)(C)OC(=O)N1CC(C=O)C1.O |
| InChI | InChI=1S/C9H15NO3.C2H6.H2O/c1-9(2,3)13-8(12)10-4-7(5-10)6-11;1-2;/h6-7H,4-5H2,1-3H3;1-2H3;1H2 |
| InChIKey | ZDMWJNIHBGWNOR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate?
The IUPAC name of tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate (CID 156709755) is tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate.
What is the SMILES notation for tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate?
The canonical SMILES for tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate is CC.CC(C)(C)OC(=O)N1CC(C=O)C1.O.
What is the InChIKey of tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate?
The InChIKey is ZDMWJNIHBGWNOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3.C2H6.H2O/c1-9(2,3)13-8(12)10-4-7(5-10)6-11;1-2;/h6-7H,4-5H2,1-3H3;1-2H3;1H2.
What are the key properties of tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate?
tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate has a molecular weight of 233.31 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-formylazetidine-1-carboxylate;ethane;hydrate is sourced from PubChem (CID 156709755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).