C14H26N2O3 — CID 134459183
tert-butyl 3-formyl-5,7-dimethyl-1,5-diazocane-1-carboxylate (PubChem CID 134459183) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl 3-formyl-5,7-dimethyl-1,5-diazocane-1-carboxylate.
| Compound Name | tert-butyl 3-formyl-5,7-dimethyl-1,5-diazocane-1-carboxylate |
|---|---|
| PubChem CID | 134459183 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | tert-butyl 3-formyl-5,7-dimethyl-1,5-diazocane-1-carboxylate |
| SMILES | CC1CN(C)CC(C=O)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H26N2O3/c1-11-6-15(5)8-12(10-17)9-16(7-11)13(18)19-14(2,3)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | ZQSQNAPBMSBARM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|