About bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate
bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate (PubChem CID 174479814) has the molecular formula C17H29NO3
and a molecular weight of 295.42 g/mol. Its IUPAC name is bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate |
| PubChem CID | 174479814 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate |
| SMILES | C1CC2CCC12.CC(C)(C)OC(=O)N1CCC(C=O)CC1 |
| InChI | InChI=1S/C11H19NO3.C6H10/c1-11(2,3)15-10(14)12-6-4-9(8-13)5-7-12;1-2-6-4-3-5(1)6/h8-9H,4-7H2,1-3H3;5-6H,1-4H2 |
| InChIKey | OOTLMCMMHGNULQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate?
The IUPAC name of bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate (CID 174479814) is bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate.
What is the SMILES notation for bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate?
The canonical SMILES for bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate is C1CC2CCC12.CC(C)(C)OC(=O)N1CCC(C=O)CC1.
What is the InChIKey of bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate?
The InChIKey is OOTLMCMMHGNULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3.C6H10/c1-11(2,3)15-10(14)12-6-4-9(8-13)5-7-12;1-2-6-4-3-5(1)6/h8-9H,4-7H2,1-3H3;5-6H,1-4H2.
What are the key properties of bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate?
bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate has a molecular weight of 295.42 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexane;tert-butyl 4-formylpiperidine-1-carboxylate is sourced from PubChem (CID 174479814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).