About tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine
tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine (PubChem CID 177023787) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine.
Molecular Properties
| Compound Name | tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine |
| PubChem CID | 177023787 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C=O)C1.c1ccncc1 |
| InChI | InChI=1S/C10H17NO3.C5H5N/c1-10(2,3)14-9(13)11-5-4-8(6-11)7-12;1-2-4-6-5-3-1/h7-8H,4-6H2,1-3H3;1-5H/t8-;/m0./s1 |
| InChIKey | SJRMSWSKWCBBPT-QRPNPIFTSA-N |
| XLogP | 2.52 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine?
The IUPAC name of tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine (CID 177023787) is tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine.
What is the SMILES notation for tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine?
The canonical SMILES for tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine is CC(C)(C)OC(=O)N1CC[C@H](C=O)C1.c1ccncc1.
What is the InChIKey of tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine?
The InChIKey is SJRMSWSKWCBBPT-QRPNPIFTSA-N. The full InChI is InChI=1S/C10H17NO3.C5H5N/c1-10(2,3)14-9(13)11-5-4-8(6-11)7-12;1-2-4-6-5-3-1/h7-8H,4-6H2,1-3H3;1-5H/t8-;/m0./s1.
What are the key properties of tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine?
tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine has a molecular weight of 278.35 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-formylpyrrolidine-1-carboxylate;pyridine is sourced from PubChem (CID 177023787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).