C10H21NO4 — CID 145288050
tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate;methanol (PubChem CID 145288050) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate;methanol.
| Compound Name | tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 145288050 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | tert-butyl (3R)-3-hydroxypyrrolidine-1-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](O)C1.CO |
| InChI | InChI=1S/C9H17NO3.CH4O/c1-9(2,3)13-8(12)10-5-4-7(11)6-10;1-2/h7,11H,4-6H2,1-3H3;2H,1H3/t7-;/m1./s1 |
| InChIKey | AHOGHZQCQNYMOX-OGFXRTJISA-N |
| XLogP | 0.60 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |